C12H9ClN6O4 — CID 87880039
4-chloro-6-[(3,5-dinitrophenyl)diazenyl]benzene-1,3-diamine (PubChem CID 87880039) has the molecular formula C12H9ClN6O4 and a molecular weight of 336.70 g/mol. Its IUPAC name is 4-chloro-6-[(3,5-dinitrophenyl)diazenyl]benzene-1,3-diamine.
| Compound Name | 4-chloro-6-[(3,5-dinitrophenyl)diazenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 87880039 |
| Molecular Formula | C12H9ClN6O4 |
| Molecular Weight | 336.70 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 4-chloro-6-[(3,5-dinitrophenyl)diazenyl]benzene-1,3-diamine |
| SMILES | Nc1cc(N)c(/N=N/c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1Cl |
| InChI | InChI=1S/C12H9ClN6O4/c13-9-4-12(11(15)5-10(9)14)17-16-6-1-7(18(20)21)3-8(2-6)19(22)23/h1-5H,14-15H2/b17-16+ |
| InChIKey | ZXTAZEDTHBOUMS-WUKNDPDISA-N |
| XLogP | 3.74 |
| TPSA | 163.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|