About 2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate
2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate (PubChem CID 7142176) has the molecular formula C12H8N6O8S-2
and a molecular weight of 396.30 g/mol. Its IUPAC name is 2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate.
Molecular Properties
| Compound Name | 2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate |
| PubChem CID | 7142176 |
| Molecular Formula | C12H8N6O8S-2 |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate |
| SMILES | Nc1cc(N)c(S(=O)(=O)[O-])cc1/N=N/c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C12H10N6O8S/c13-6-3-7(14)11(27(24,25)26)4-8(6)15-16-9-1-5(17(20)21)2-10(12(9)19)18(22)23/h1-4,19H,13-14H2,(H,24,25,26)/p-2/b16-15+ |
| InChIKey | YELYYJBDBXBBTL-FOCLMDBBSA-L |
| XLogP | 1.06 |
| TPSA | 243.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate?
The IUPAC name of 2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate (CID 7142176) is 2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate.
What is the SMILES notation for 2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate?
The canonical SMILES for 2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate is Nc1cc(N)c(S(=O)(=O)[O-])cc1/N=N/c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1[O-].
What is the InChIKey of 2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate?
The InChIKey is YELYYJBDBXBBTL-FOCLMDBBSA-L. The full InChI is InChI=1S/C12H10N6O8S/c13-6-3-7(14)11(27(24,25)26)4-8(6)15-16-9-1-5(17(20)21)2-10(12(9)19)18(22)23/h1-4,19H,13-14H2,(H,24,25,26)/p-2/b16-15+.
What are the key properties of 2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate?
2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate has a molecular weight of 396.30 g/mol, XLogP of 1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-5-[(3,5-dinitro-2-oxidophenyl)diazenyl]benzenesulfonate is sourced from PubChem (CID 7142176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).