C23H26N6O2 — CID 139626772
3-[(dibutylamino)methyl]-6-[(3-nitrophenyl)diazenyl]benzene-1,2-dicarbonitrile (PubChem CID 139626772) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 3-[(dibutylamino)methyl]-6-[(3-nitrophenyl)diazenyl]benzene-1,2-dicarbonitrile.
| Compound Name | 3-[(dibutylamino)methyl]-6-[(3-nitrophenyl)diazenyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139626772 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 3-[(dibutylamino)methyl]-6-[(3-nitrophenyl)diazenyl]benzene-1,2-dicarbonitrile |
| SMILES | CCCCN(CCCC)Cc1ccc(/N=N/c2cccc([N+](=O)[O-])c2)c(C#N)c1C#N |
| InChI | InChI=1S/C23H26N6O2/c1-3-5-12-28(13-6-4-2)17-18-10-11-23(22(16-25)21(18)15-24)27-26-19-8-7-9-20(14-19)29(30)31/h7-11,14H,3-6,12-13,17H2,1-2H3/b27-26+ |
| InChIKey | UNNUJNMWMPKEQO-CYYJNZCTSA-N |
| XLogP | 6.16 |
| TPSA | 118.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|