C13H14Cl2N2 — CID 55038842
4-chloro-1-[4-(chloromethyl)-3-methylphenyl]-3,5-dimethylpyrazole (PubChem CID 55038842) has the molecular formula C13H14Cl2N2 and a molecular weight of 269.18 g/mol. Its IUPAC name is 4-chloro-1-[4-(chloromethyl)-3-methylphenyl]-3,5-dimethylpyrazole.
| Compound Name | 4-chloro-1-[4-(chloromethyl)-3-methylphenyl]-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 55038842 |
| Molecular Formula | C13H14Cl2N2 |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 4-chloro-1-[4-(chloromethyl)-3-methylphenyl]-3,5-dimethylpyrazole |
| SMILES | Cc1cc(-n2nc(C)c(Cl)c2C)ccc1CCl |
| InChI | InChI=1S/C13H14Cl2N2/c1-8-6-12(5-4-11(8)7-14)17-10(3)13(15)9(2)16-17/h4-6H,7H2,1-3H3 |
| InChIKey | KWFAARZIXNPFLE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|