C13H14Cl2N4 — CID 169368579
2-chloro-N'-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)phenyl]ethanimidamide (PubChem CID 169368579) has the molecular formula C13H14Cl2N4 and a molecular weight of 297.19 g/mol. Its IUPAC name is 2-chloro-N'-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169368579 |
| Molecular Formula | C13H14Cl2N4 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-chloro-N'-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)phenyl]ethanimidamide |
| SMILES | Cc1nn(-c2ccc(/N=C(/N)CCl)cc2)c(C)c1Cl |
| InChI | InChI=1S/C13H14Cl2N4/c1-8-13(15)9(2)19(18-8)11-5-3-10(4-6-11)17-12(16)7-14/h3-6H,7H2,1-2H3,(H2,16,17) |
| InChIKey | MEHSJNQUJLLMKU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|