C13H13ClN4S — CID 62129326
5-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-methyl-1,3-benzothiazol-6-amine (PubChem CID 62129326) has the molecular formula C13H13ClN4S and a molecular weight of 292.80 g/mol. Its IUPAC name is 5-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-methyl-1,3-benzothiazol-6-amine.
| Compound Name | 5-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-methyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 62129326 |
| Molecular Formula | C13H13ClN4S |
| Molecular Weight | 292.80 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 5-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-methyl-1,3-benzothiazol-6-amine |
| SMILES | Cc1nc2cc(-n3nc(C)c(Cl)c3C)c(N)cc2s1 |
| InChI | InChI=1S/C13H13ClN4S/c1-6-13(14)7(2)18(17-6)11-5-10-12(4-9(11)15)19-8(3)16-10/h4-5H,15H2,1-3H3 |
| InChIKey | IGRPNBBUZBZDIP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|