C13H13ClN4O — CID 62129661
5-amino-6-(4-chloro-3,5-dimethylpyrazol-1-yl)-1,3-dihydroindol-2-one (PubChem CID 62129661) has the molecular formula C13H13ClN4O and a molecular weight of 276.73 g/mol. Its IUPAC name is 5-amino-6-(4-chloro-3,5-dimethylpyrazol-1-yl)-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-(4-chloro-3,5-dimethylpyrazol-1-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 62129661 |
| Molecular Formula | C13H13ClN4O |
| Molecular Weight | 276.73 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 5-amino-6-(4-chloro-3,5-dimethylpyrazol-1-yl)-1,3-dihydroindol-2-one |
| SMILES | Cc1nn(-c2cc3c(cc2N)CC(=O)N3)c(C)c1Cl |
| InChI | InChI=1S/C13H13ClN4O/c1-6-13(14)7(2)18(17-6)11-5-10-8(3-9(11)15)4-12(19)16-10/h3,5H,4,15H2,1-2H3,(H,16,19) |
| InChIKey | CJQSDAJLBZNRCT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.73 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|