About 5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one
5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one (PubChem CID 55216307) has the molecular formula C13H16N4O2
and a molecular weight of 260.30 g/mol. Its IUPAC name is 5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one |
| PubChem CID | 55216307 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one |
| SMILES | CC1C(=O)NCCN1c1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C13H16N4O2/c1-7-13(19)15-2-3-17(7)11-6-10-8(4-9(11)14)5-12(18)16-10/h4,6-7H,2-3,5,14H2,1H3,(H,15,19)(H,16,18) |
| InChIKey | RGZKVAQLMRYIMF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one?
The IUPAC name of 5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one (CID 55216307) is 5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one?
The canonical SMILES for 5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one is CC1C(=O)NCCN1c1cc2c(cc1N)CC(=O)N2.
What is the InChIKey of 5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one?
The InChIKey is RGZKVAQLMRYIMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2/c1-7-13(19)15-2-3-17(7)11-6-10-8(4-9(11)14)5-12(18)16-10/h4,6-7H,2-3,5,14H2,1H3,(H,15,19)(H,16,18).
What are the key properties of 5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one?
5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one has a molecular weight of 260.30 g/mol, XLogP of 0.09, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-(2-methyl-3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one is sourced from PubChem (CID 55216307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).