C14H19N3O2 — CID 61430219
5-amino-6-(3,3-dimethylmorpholin-4-yl)-1,3-dihydroindol-2-one (PubChem CID 61430219) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-amino-6-(3,3-dimethylmorpholin-4-yl)-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-(3,3-dimethylmorpholin-4-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61430219 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 5-amino-6-(3,3-dimethylmorpholin-4-yl)-1,3-dihydroindol-2-one |
| SMILES | CC1(C)COCCN1c1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C14H19N3O2/c1-14(2)8-19-4-3-17(14)12-7-11-9(5-10(12)15)6-13(18)16-11/h5,7H,3-4,6,8,15H2,1-2H3,(H,16,18) |
| InChIKey | OTGBSTGKVORQSG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|