C14H20N4O2 — CID 79082505
5-amino-6-[(4-methylmorpholin-2-yl)methylamino]-1,3-dihydroindol-2-one (PubChem CID 79082505) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 5-amino-6-[(4-methylmorpholin-2-yl)methylamino]-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-[(4-methylmorpholin-2-yl)methylamino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79082505 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 5-amino-6-[(4-methylmorpholin-2-yl)methylamino]-1,3-dihydroindol-2-one |
| SMILES | CN1CCOC(CNc2cc3c(cc2N)CC(=O)N3)C1 |
| InChI | InChI=1S/C14H20N4O2/c1-18-2-3-20-10(8-18)7-16-13-6-12-9(4-11(13)15)5-14(19)17-12/h4,6,10,16H,2-3,5,7-8,15H2,1H3,(H,17,19) |
| InChIKey | YFERMDHUVUFFMW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|