C12H17BrFN3O — CID 79083379
4-bromo-5-fluoro-1-N-[(4-methylmorpholin-2-yl)methyl]benzene-1,2-diamine (PubChem CID 79083379) has the molecular formula C12H17BrFN3O and a molecular weight of 318.19 g/mol. Its IUPAC name is 4-bromo-5-fluoro-1-N-[(4-methylmorpholin-2-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-5-fluoro-1-N-[(4-methylmorpholin-2-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 79083379 |
| Molecular Formula | C12H17BrFN3O |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 4-bromo-5-fluoro-1-N-[(4-methylmorpholin-2-yl)methyl]benzene-1,2-diamine |
| SMILES | CN1CCOC(CNc2cc(F)c(Br)cc2N)C1 |
| InChI | InChI=1S/C12H17BrFN3O/c1-17-2-3-18-8(7-17)6-16-12-5-10(14)9(13)4-11(12)15/h4-5,8,16H,2-3,6-7,15H2,1H3 |
| InChIKey | GMVQQTMWAKHUIE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|