C15H19N5O — CID 79224507
5-amino-6-[(1,3,5-trimethylpyrazol-4-yl)methylamino]-1,3-dihydroindol-2-one (PubChem CID 79224507) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 5-amino-6-[(1,3,5-trimethylpyrazol-4-yl)methylamino]-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-[(1,3,5-trimethylpyrazol-4-yl)methylamino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79224507 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 5-amino-6-[(1,3,5-trimethylpyrazol-4-yl)methylamino]-1,3-dihydroindol-2-one |
| SMILES | Cc1nn(C)c(C)c1CNc1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C15H19N5O/c1-8-11(9(2)20(3)19-8)7-17-14-6-13-10(4-12(14)16)5-15(21)18-13/h4,6,17H,5,7,16H2,1-3H3,(H,18,21) |
| InChIKey | MYAYNSCBKMGEMA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|