C13H15N5O — CID 54982616
5-amino-6-[(5-methyl-1H-pyrazol-4-yl)methylamino]-1,3-dihydroindol-2-one (PubChem CID 54982616) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 5-amino-6-[(5-methyl-1H-pyrazol-4-yl)methylamino]-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-[(5-methyl-1H-pyrazol-4-yl)methylamino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 54982616 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 5-amino-6-[(5-methyl-1H-pyrazol-4-yl)methylamino]-1,3-dihydroindol-2-one |
| SMILES | Cc1[nH]ncc1CNc1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C13H15N5O/c1-7-9(6-16-18-7)5-15-12-4-11-8(2-10(12)14)3-13(19)17-11/h2,4,6,15H,3,5,14H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | ZNGZWILFNZDPRG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|