C14H14N4O — CID 43451706
5-amino-6-(pyridin-2-ylmethylamino)-1,3-dihydroindol-2-one (PubChem CID 43451706) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 5-amino-6-(pyridin-2-ylmethylamino)-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-(pyridin-2-ylmethylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43451706 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 5-amino-6-(pyridin-2-ylmethylamino)-1,3-dihydroindol-2-one |
| SMILES | Nc1cc2c(cc1NCc1ccccn1)NC(=O)C2 |
| InChI | InChI=1S/C14H14N4O/c15-11-5-9-6-14(19)18-12(9)7-13(11)17-8-10-3-1-2-4-16-10/h1-5,7,17H,6,8,15H2,(H,18,19) |
| InChIKey | PRWVOWGJXOIAQL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|