C15H18N4O2 — CID 103194517
1-(5-amino-2-oxo-1,3-dihydroindol-6-yl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103194517) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-(5-amino-2-oxo-1,3-dihydroindol-6-yl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-(5-amino-2-oxo-1,3-dihydroindol-6-yl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103194517 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-(5-amino-2-oxo-1,3-dihydroindol-6-yl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | Nc1cc2c(cc1N1CCCC3C(=O)NCC31)NC(=O)C2 |
| InChI | InChI=1S/C15H18N4O2/c16-10-4-8-5-14(20)18-11(8)6-12(10)19-3-1-2-9-13(19)7-17-15(9)21/h4,6,9,13H,1-3,5,7,16H2,(H,17,21)(H,18,20) |
| InChIKey | CIMPDFYLRIQWMM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|