C10H11FN4 — CID 104738895
1-(3-fluoro-4-pyridinyl)-3,5-dimethylpyrazol-4-amine (PubChem CID 104738895) has the molecular formula C10H11FN4 and a molecular weight of 206.22 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyridinyl)-3,5-dimethylpyrazol-4-amine.
| Compound Name | 1-(3-fluoro-4-pyridinyl)-3,5-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 104738895 |
| Molecular Formula | C10H11FN4 |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 1-(3-fluoro-4-pyridinyl)-3,5-dimethylpyrazol-4-amine |
| SMILES | Cc1nn(-c2ccncc2F)c(C)c1N |
| InChI | InChI=1S/C10H11FN4/c1-6-10(12)7(2)15(14-6)9-3-4-13-5-8(9)11/h3-5H,12H2,1-2H3 |
| InChIKey | UCCRTVLLFNYNIZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |