C12H7N5O2 — CID 112595307
2-amino-3-(4,5-dicyanoimidazol-1-yl)benzoic acid (PubChem CID 112595307) has the molecular formula C12H7N5O2 and a molecular weight of 253.22 g/mol. Its IUPAC name is 2-amino-3-(4,5-dicyanoimidazol-1-yl)benzoic acid.
| Compound Name | 2-amino-3-(4,5-dicyanoimidazol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 112595307 |
| Molecular Formula | C12H7N5O2 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-amino-3-(4,5-dicyanoimidazol-1-yl)benzoic acid |
| SMILES | N#Cc1ncn(-c2cccc(C(=O)O)c2N)c1C#N |
| InChI | InChI=1S/C12H7N5O2/c13-4-8-10(5-14)17(6-16-8)9-3-1-2-7(11(9)15)12(18)19/h1-3,6H,15H2,(H,18,19) |
| InChIKey | OFCLXXFTMXLYJF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|