C12H8N6O — CID 112595314
3-amino-2-(4,5-dicyanoimidazol-1-yl)benzamide (PubChem CID 112595314) has the molecular formula C12H8N6O and a molecular weight of 252.24 g/mol. Its IUPAC name is 3-amino-2-(4,5-dicyanoimidazol-1-yl)benzamide.
| Compound Name | 3-amino-2-(4,5-dicyanoimidazol-1-yl)benzamide |
|---|---|
| PubChem CID | 112595314 |
| Molecular Formula | C12H8N6O |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-amino-2-(4,5-dicyanoimidazol-1-yl)benzamide |
| SMILES | N#Cc1ncn(-c2c(N)cccc2C(N)=O)c1C#N |
| InChI | InChI=1S/C12H8N6O/c13-4-9-10(5-14)18(6-17-9)11-7(12(16)19)2-1-3-8(11)15/h1-3,6H,15H2,(H2,16,19) |
| InChIKey | AOFGRYLEAUIMGZ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 134.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|