C11H11N5O2 — CID 113384284
1-(azetidin-3-yl)-3-(3-nitrophenyl)-1,2,4-triazole (PubChem CID 113384284) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-3-(3-nitrophenyl)-1,2,4-triazole.
| Compound Name | 1-(azetidin-3-yl)-3-(3-nitrophenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 113384284 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 1-(azetidin-3-yl)-3-(3-nitrophenyl)-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cccc(-c2ncn(C3CNC3)n2)c1 |
| InChI | InChI=1S/C11H11N5O2/c17-16(18)9-3-1-2-8(4-9)11-13-7-15(14-11)10-5-12-6-10/h1-4,7,10,12H,5-6H2 |
| InChIKey | WTWGXPBUFDXYFK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|