C17H13F4N3OS — CID 43021955
N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 43021955) has the molecular formula C17H13F4N3OS and a molecular weight of 383.37 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 43021955 |
| Molecular Formula | C17H13F4N3OS |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1ccc(C(F)(F)F)n1)NC(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C17H13F4N3OS/c18-12-5-3-11(4-6-12)16(13-2-1-9-26-13)22-15(25)10-24-8-7-14(23-24)17(19,20)21/h1-9,16H,10H2,(H,22,25) |
| InChIKey | LCNUPLBRMSWNMA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |