C18H16FN3O4S — CID 9342029
2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide (PubChem CID 9342029) has the molecular formula C18H16FN3O4S and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide.
| Compound Name | 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide |
|---|---|
| PubChem CID | 9342029 |
| Molecular Formula | C18H16FN3O4S |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide |
| SMILES | CCN1C(=O)C(=O)N(CC(=O)N[C@@H](c2ccc(F)cc2)c2cccs2)C1=O |
| InChI | InChI=1S/C18H16FN3O4S/c1-2-21-16(24)17(25)22(18(21)26)10-14(23)20-15(13-4-3-9-27-13)11-5-7-12(19)8-6-11/h3-9,15H,2,10H2,1H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | CGEDGBTYJBDVJO-HNNXBMFYSA-N |
| XLogP | 1.90 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|