C23H19FN2O7S — CID 55402001
1-O-ethyl 3-O-[2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 55402001) has the molecular formula C23H19FN2O7S and a molecular weight of 486.48 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 1-O-ethyl 3-O-[2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55402001 |
| Molecular Formula | C23H19FN2O7S |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 1-O-ethyl 3-O-[2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC(=O)NC(c2ccc(F)cc2)c2cccs2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H19FN2O7S/c1-2-32-22(28)15-10-16(12-18(11-15)26(30)31)23(29)33-13-20(27)25-21(19-4-3-9-34-19)14-5-7-17(24)8-6-14/h3-12,21H,2,13H2,1H3,(H,25,27) |
| InChIKey | MXULDSLHVNSFEM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|