C21H16F3NO4S — CID 46613600
[2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 3-(difluoromethoxy)benzoate (PubChem CID 46613600) has the molecular formula C21H16F3NO4S and a molecular weight of 435.42 g/mol. Its IUPAC name is [2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 3-(difluoromethoxy)benzoate.
| Compound Name | [2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 3-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 46613600 |
| Molecular Formula | C21H16F3NO4S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | [2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 3-(difluoromethoxy)benzoate |
| SMILES | O=C(COC(=O)c1cccc(OC(F)F)c1)NC(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C21H16F3NO4S/c22-15-8-6-13(7-9-15)19(17-5-2-10-30-17)25-18(26)12-28-20(27)14-3-1-4-16(11-14)29-21(23)24/h1-11,19,21H,12H2,(H,25,26) |
| InChIKey | ZWMSNROGHWDPBK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |