C21H16FNO4S — CID 9019761
[2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 4-formylbenzoate (PubChem CID 9019761) has the molecular formula C21H16FNO4S and a molecular weight of 397.43 g/mol. Its IUPAC name is [2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 9019761 |
| Molecular Formula | C21H16FNO4S |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | [2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCC(=O)N[C@H](c2ccc(F)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C21H16FNO4S/c22-17-9-7-15(8-10-17)20(18-2-1-11-28-18)23-19(25)13-27-21(26)16-5-3-14(12-24)4-6-16/h1-12,20H,13H2,(H,23,25)/t20-/m1/s1 |
| InChIKey | AWWIRMXKBMLUMR-HXUWFJFHSA-N |
| XLogP | 3.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|