C17H17ClN2O5 — CID 7932010
N-[(1R)-1-(3-chlorophenyl)ethyl]-2-(2-methoxy-5-nitrophenoxy)acetamide (PubChem CID 7932010) has the molecular formula C17H17ClN2O5 and a molecular weight of 364.79 g/mol. Its IUPAC name is N-[(1R)-1-(3-chlorophenyl)ethyl]-2-(2-methoxy-5-nitrophenoxy)acetamide.
| Compound Name | N-[(1R)-1-(3-chlorophenyl)ethyl]-2-(2-methoxy-5-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 7932010 |
| Molecular Formula | C17H17ClN2O5 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | N-[(1R)-1-(3-chlorophenyl)ethyl]-2-(2-methoxy-5-nitrophenoxy)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1OCC(=O)N[C@H](C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H17ClN2O5/c1-11(12-4-3-5-13(18)8-12)19-17(21)10-25-16-9-14(20(22)23)6-7-15(16)24-2/h3-9,11H,10H2,1-2H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | JTHOOHCUMJAHHK-LLVKDONJSA-N |
| XLogP | 3.51 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|