C20H19NO3S2 — CID 8631099
[2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 3-thiophen-3-ylpropanoate (PubChem CID 8631099) has the molecular formula C20H19NO3S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 3-thiophen-3-ylpropanoate.
| Compound Name | [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 8631099 |
| Molecular Formula | C20H19NO3S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 3-thiophen-3-ylpropanoate |
| SMILES | O=C(COC(=O)CCc1ccsc1)N[C@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C20H19NO3S2/c22-18(13-24-19(23)9-8-15-10-12-25-14-15)21-20(17-7-4-11-26-17)16-5-2-1-3-6-16/h1-7,10-12,14,20H,8-9,13H2,(H,21,22)/t20-/m1/s1 |
| InChIKey | ATHGPQQIEPQRMD-HXUWFJFHSA-N |
| XLogP | 4.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |