C21H18N2O5S — CID 9344318
[2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 2-(2-nitrophenyl)acetate (PubChem CID 9344318) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is [2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 2-(2-nitrophenyl)acetate.
| Compound Name | [2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 2-(2-nitrophenyl)acetate |
|---|---|
| PubChem CID | 9344318 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 2-(2-nitrophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccccc1[N+](=O)[O-])N[C@@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C21H18N2O5S/c24-19(14-28-20(25)13-16-9-4-5-10-17(16)23(26)27)22-21(18-11-6-12-29-18)15-7-2-1-3-8-15/h1-12,21H,13-14H2,(H,22,24)/t21-/m0/s1 |
| InChIKey | DFASCDBFUIJHJU-NRFANRHFSA-N |
| XLogP | 3.65 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|