C23H27NO4 — CID 7227188
[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-oxo-4-(4-propylphenyl)butanoate (PubChem CID 7227188) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-oxo-4-(4-propylphenyl)butanoate.
| Compound Name | [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-oxo-4-(4-propylphenyl)butanoate |
|---|---|
| PubChem CID | 7227188 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-oxo-4-(4-propylphenyl)butanoate |
| SMILES | CCCc1ccc(C(=O)CCC(=O)OCC(=O)N[C@@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-3-7-18-10-12-20(13-11-18)21(25)14-15-23(27)28-16-22(26)24-17(2)19-8-5-4-6-9-19/h4-6,8-13,17H,3,7,14-16H2,1-2H3,(H,24,26)/t17-/m0/s1 |
| InChIKey | YCBHHRCGWIWBQM-KRWDZBQOSA-N |
| XLogP | 4.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |