C24H29NO4 — CID 8522192
[2-[[(1R)-3-methyl-1-phenylbutyl]amino]-2-oxoethyl] 4-(4-methylphenyl)-4-oxobutanoate (PubChem CID 8522192) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is [2-[[(1R)-3-methyl-1-phenylbutyl]amino]-2-oxoethyl] 4-(4-methylphenyl)-4-oxobutanoate.
| Compound Name | [2-[[(1R)-3-methyl-1-phenylbutyl]amino]-2-oxoethyl] 4-(4-methylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 8522192 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | [2-[[(1R)-3-methyl-1-phenylbutyl]amino]-2-oxoethyl] 4-(4-methylphenyl)-4-oxobutanoate |
| SMILES | Cc1ccc(C(=O)CCC(=O)OCC(=O)N[C@H](CC(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-17(2)15-21(19-7-5-4-6-8-19)25-23(27)16-29-24(28)14-13-22(26)20-11-9-18(3)10-12-20/h4-12,17,21H,13-16H2,1-3H3,(H,25,27)/t21-/m1/s1 |
| InChIKey | PJORTIHEMIJMPY-OAQYLSRUSA-N |
| XLogP | 4.40 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |