C10H11NO5S2 — CID 71402009
(2R)-3-(carboxymethylsulfanyl)-2-(thiophene-2-carbonylamino)propanoic acid (PubChem CID 71402009) has the molecular formula C10H11NO5S2 and a molecular weight of 289.33 g/mol. Its IUPAC name is (2R)-3-(carboxymethylsulfanyl)-2-(thiophene-2-carbonylamino)propanoic acid.
| Compound Name | (2R)-3-(carboxymethylsulfanyl)-2-(thiophene-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 71402009 |
| Molecular Formula | C10H11NO5S2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | (2R)-3-(carboxymethylsulfanyl)-2-(thiophene-2-carbonylamino)propanoic acid |
| SMILES | O=C(O)CSC[C@H](NC(=O)c1cccs1)C(=O)O |
| InChI | InChI=1S/C10H11NO5S2/c12-8(13)5-17-4-6(10(15)16)11-9(14)7-2-1-3-18-7/h1-3,6H,4-5H2,(H,11,14)(H,12,13)(H,15,16)/t6-/m0/s1 |
| InChIKey | MDXISJICTJSESP-LURJTMIESA-N |
| XLogP | 0.75 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |