C10H8F2O5 — CID 141416717
methyl 3-(4,5-difluoro-2,3-dihydroxyphenyl)-3-oxopropanoate (PubChem CID 141416717) has the molecular formula C10H8F2O5 and a molecular weight of 246.16 g/mol. Its IUPAC name is methyl 3-(4,5-difluoro-2,3-dihydroxyphenyl)-3-oxopropanoate.
| Compound Name | methyl 3-(4,5-difluoro-2,3-dihydroxyphenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 141416717 |
| Molecular Formula | C10H8F2O5 |
| Molecular Weight | 246.16 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | methyl 3-(4,5-difluoro-2,3-dihydroxyphenyl)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)c1cc(F)c(F)c(O)c1O |
| InChI | InChI=1S/C10H8F2O5/c1-17-7(14)3-6(13)4-2-5(11)8(12)10(16)9(4)15/h2,15-16H,3H2,1H3 |
| InChIKey | SJUNUUDKGHANQI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.16 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|