3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid

C12H12F3NO4 — CID 103153081

IUPAC3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid
SMILESCOC(CNC(=O)c1c(F)cc(F)cc1F)CC(=O)O
InChIInChI=1S/C12H12F3NO4/c1-20-7(4-10(17)18)5-16-12(19)11-8(14)2-6(13)3-9(11)15/h2-3,7H,4-5H2,1H3,(H,16,19)(H,17,18)
InChIKeyDDVUCWMAPNXDKZ-UHFFFAOYSA-N
MW291.22 g/mol
LogP1.32
Rot. Bonds6

About 3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid

3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid (PubChem CID 103153081) has the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. Its IUPAC name is 3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid.

Molecular Properties

Compound Name3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid
PubChem CID103153081
Molecular FormulaC12H12F3NO4
Molecular Weight291.22 g/mol
Exact Mass291.07
IUPAC Name3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid
SMILESCOC(CNC(=O)c1c(F)cc(F)cc1F)CC(=O)O
InChIInChI=1S/C12H12F3NO4/c1-20-7(4-10(17)18)5-16-12(19)11-8(14)2-6(13)3-9(11)15/h2-3,7H,4-5H2,1H3,(H,16,19)(H,17,18)
InChIKeyDDVUCWMAPNXDKZ-UHFFFAOYSA-N
XLogP1.32
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.22
LogP ≤ 51.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid?
The IUPAC name of 3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid (CID 103153081) is 3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid.
What is the SMILES notation for 3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid?
The canonical SMILES for 3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid is COC(CNC(=O)c1c(F)cc(F)cc1F)CC(=O)O.
What is the InChIKey of 3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid?
The InChIKey is DDVUCWMAPNXDKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3NO4/c1-20-7(4-10(17)18)5-16-12(19)11-8(14)2-6(13)3-9(11)15/h2-3,7H,4-5H2,1H3,(H,16,19)(H,17,18).
What are the key properties of 3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid?
3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid has a molecular weight of 291.22 g/mol, XLogP of 1.32, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid is sourced from PubChem (CID 103153081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).