C12H12F3NO4 — CID 103153081
3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid (PubChem CID 103153081) has the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. Its IUPAC name is 3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid.
| Compound Name | 3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 103153081 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-methoxy-4-[(2,4,6-trifluorobenzoyl)amino]butanoic acid |
| SMILES | COC(CNC(=O)c1c(F)cc(F)cc1F)CC(=O)O |
| InChI | InChI=1S/C12H12F3NO4/c1-20-7(4-10(17)18)5-16-12(19)11-8(14)2-6(13)3-9(11)15/h2-3,7H,4-5H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | DDVUCWMAPNXDKZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |