C12H13FN2O6 — CID 103152653
4-[(4-fluoro-2-nitrobenzoyl)amino]-3-methoxybutanoic acid (PubChem CID 103152653) has the molecular formula C12H13FN2O6 and a molecular weight of 300.24 g/mol. Its IUPAC name is 4-[(4-fluoro-2-nitrobenzoyl)amino]-3-methoxybutanoic acid.
| Compound Name | 4-[(4-fluoro-2-nitrobenzoyl)amino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103152653 |
| Molecular Formula | C12H13FN2O6 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-[(4-fluoro-2-nitrobenzoyl)amino]-3-methoxybutanoic acid |
| SMILES | COC(CNC(=O)c1ccc(F)cc1[N+](=O)[O-])CC(=O)O |
| InChI | InChI=1S/C12H13FN2O6/c1-21-8(5-11(16)17)6-14-12(18)9-3-2-7(13)4-10(9)15(19)20/h2-4,8H,5-6H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | BWUCMXBIGLPUBV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|