C12H13BrF2N2O4 — CID 107614382
4-[(4-bromo-2,5-difluorophenyl)carbamoylamino]-3-methoxybutanoic acid (PubChem CID 107614382) has the molecular formula C12H13BrF2N2O4 and a molecular weight of 367.15 g/mol. Its IUPAC name is 4-[(4-bromo-2,5-difluorophenyl)carbamoylamino]-3-methoxybutanoic acid.
| Compound Name | 4-[(4-bromo-2,5-difluorophenyl)carbamoylamino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 107614382 |
| Molecular Formula | C12H13BrF2N2O4 |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 4-[(4-bromo-2,5-difluorophenyl)carbamoylamino]-3-methoxybutanoic acid |
| SMILES | COC(CNC(=O)Nc1cc(F)c(Br)cc1F)CC(=O)O |
| InChI | InChI=1S/C12H13BrF2N2O4/c1-21-6(2-11(18)19)5-16-12(20)17-10-4-8(14)7(13)3-9(10)15/h3-4,6H,2,5H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | WOPAWHTXQZIUDE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|