C11H13N3O5 — CID 105063070
4-amino-2-[(3-methoxypyridine-4-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 105063070) has the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. Its IUPAC name is 4-amino-2-[(3-methoxypyridine-4-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(3-methoxypyridine-4-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 105063070 |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-amino-2-[(3-methoxypyridine-4-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | COc1cnccc1C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H13N3O5/c1-19-8-5-13-3-2-6(8)10(16)14-7(11(17)18)4-9(12)15/h2-3,5,7H,4H2,1H3,(H2,12,15)(H,14,16)(H,17,18) |
| InChIKey | RDHZAUUJFKRRBI-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |