C10H13ClN2O2 — CID 105064527
N-(1-chloropropan-2-yl)-3-methoxypyridine-4-carboxamide (PubChem CID 105064527) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-3-methoxypyridine-4-carboxamide.
| Compound Name | N-(1-chloropropan-2-yl)-3-methoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 105064527 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | N-(1-chloropropan-2-yl)-3-methoxypyridine-4-carboxamide |
| SMILES | COc1cnccc1C(=O)NC(C)CCl |
| InChI | InChI=1S/C10H13ClN2O2/c1-7(5-11)13-10(14)8-3-4-12-6-9(8)15-2/h3-4,6-7H,5H2,1-2H3,(H,13,14) |
| InChIKey | WQHZQBXQVMPWPW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|