C15H26N2O2S — CID 120665116
N-[(2R)-2-(ethylamino)propyl]-2,3,5,6-tetramethylbenzenesulfonamide (PubChem CID 120665116) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-2,3,5,6-tetramethylbenzenesulfonamide.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-2,3,5,6-tetramethylbenzenesulfonamide |
|---|---|
| PubChem CID | 120665116 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-2,3,5,6-tetramethylbenzenesulfonamide |
| SMILES | CCN[C@H](C)CNS(=O)(=O)c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C15H26N2O2S/c1-7-16-12(4)9-17-20(18,19)15-13(5)10(2)8-11(3)14(15)6/h8,12,16-17H,7,9H2,1-6H3/t12-/m1/s1 |
| InChIKey | BHIKYZGDBAIEBC-GFCCVEGCSA-N |
| XLogP | 2.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |