C16H23FN2O4S — CID 120720148
ethyl 3-fluoro-5-[(4-methylpiperidin-4-yl)methylsulfamoyl]benzoate (PubChem CID 120720148) has the molecular formula C16H23FN2O4S and a molecular weight of 358.44 g/mol. Its IUPAC name is ethyl 3-fluoro-5-[(4-methylpiperidin-4-yl)methylsulfamoyl]benzoate.
| Compound Name | ethyl 3-fluoro-5-[(4-methylpiperidin-4-yl)methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 120720148 |
| Molecular Formula | C16H23FN2O4S |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | ethyl 3-fluoro-5-[(4-methylpiperidin-4-yl)methylsulfamoyl]benzoate |
| SMILES | CCOC(=O)c1cc(F)cc(S(=O)(=O)NCC2(C)CCNCC2)c1 |
| InChI | InChI=1S/C16H23FN2O4S/c1-3-23-15(20)12-8-13(17)10-14(9-12)24(21,22)19-11-16(2)4-6-18-7-5-16/h8-10,18-19H,3-7,11H2,1-2H3 |
| InChIKey | SGUOURVLNPSRFK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |