C15H21FN2O4S — CID 120722828
ethyl 3-fluoro-5-[(4-methylpiperidin-3-yl)sulfamoyl]benzoate (PubChem CID 120722828) has the molecular formula C15H21FN2O4S and a molecular weight of 344.41 g/mol. Its IUPAC name is ethyl 3-fluoro-5-[(4-methylpiperidin-3-yl)sulfamoyl]benzoate.
| Compound Name | ethyl 3-fluoro-5-[(4-methylpiperidin-3-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 120722828 |
| Molecular Formula | C15H21FN2O4S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | ethyl 3-fluoro-5-[(4-methylpiperidin-3-yl)sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1cc(F)cc(S(=O)(=O)NC2CNCCC2C)c1 |
| InChI | InChI=1S/C15H21FN2O4S/c1-3-22-15(19)11-6-12(16)8-13(7-11)23(20,21)18-14-9-17-5-4-10(14)2/h6-8,10,14,17-18H,3-5,9H2,1-2H3 |
| InChIKey | RSZMREJTEBTVKP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |