C19H22ClFN2O4S — CID 120722135
ethyl 3-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]-5-fluorobenzoate;hydrochloride (PubChem CID 120722135) has the molecular formula C19H22ClFN2O4S and a molecular weight of 428.91 g/mol. Its IUPAC name is ethyl 3-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]-5-fluorobenzoate;hydrochloride.
| Compound Name | ethyl 3-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]-5-fluorobenzoate;hydrochloride |
|---|---|
| PubChem CID | 120722135 |
| Molecular Formula | C19H22ClFN2O4S |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | ethyl 3-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]-5-fluorobenzoate;hydrochloride |
| SMILES | CCOC(=O)c1cc(F)cc(S(=O)(=O)NC2CCCc3cc(N)ccc32)c1.Cl |
| InChI | InChI=1S/C19H21FN2O4S.ClH/c1-2-26-19(23)13-8-14(20)11-16(10-13)27(24,25)22-18-5-3-4-12-9-15(21)6-7-17(12)18;/h6-11,18,22H,2-5,21H2,1H3;1H |
| InChIKey | QEVNZGDDAGWYLM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|