C15H22N2O4S — CID 120708944
ethyl 4-methyl-3-(pyrrolidin-2-ylmethylsulfamoyl)benzoate (PubChem CID 120708944) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is ethyl 4-methyl-3-(pyrrolidin-2-ylmethylsulfamoyl)benzoate.
| Compound Name | ethyl 4-methyl-3-(pyrrolidin-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 120708944 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | ethyl 4-methyl-3-(pyrrolidin-2-ylmethylsulfamoyl)benzoate |
| SMILES | CCOC(=O)c1ccc(C)c(S(=O)(=O)NCC2CCCN2)c1 |
| InChI | InChI=1S/C15H22N2O4S/c1-3-21-15(18)12-7-6-11(2)14(9-12)22(19,20)17-10-13-5-4-8-16-13/h6-7,9,13,16-17H,3-5,8,10H2,1-2H3 |
| InChIKey | LZZHOPVDILYTLA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |