C14H21ClFN3O5S — CID 119992686
3-[1-(2-fluoro-6-nitrophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride (PubChem CID 119992686) has the molecular formula C14H21ClFN3O5S and a molecular weight of 397.86 g/mol. Its IUPAC name is 3-[1-(2-fluoro-6-nitrophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride.
| Compound Name | 3-[1-(2-fluoro-6-nitrophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 119992686 |
| Molecular Formula | C14H21ClFN3O5S |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 3-[1-(2-fluoro-6-nitrophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(S(=O)(=O)c2c(F)cccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H20FN3O5S.ClH/c15-12-3-1-4-13(18(19)20)14(12)24(21,22)17-8-5-11(6-9-17)23-10-2-7-16;/h1,3-4,11H,2,5-10,16H2;1H |
| InChIKey | WBPVTIXJPMSIAH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|