C13H18FN3O4S — CID 120779606
1-(2-fluoro-6-nitrophenyl)sulfonyl-3,3-dimethylpiperidin-4-amine (PubChem CID 120779606) has the molecular formula C13H18FN3O4S and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-(2-fluoro-6-nitrophenyl)sulfonyl-3,3-dimethylpiperidin-4-amine.
| Compound Name | 1-(2-fluoro-6-nitrophenyl)sulfonyl-3,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 120779606 |
| Molecular Formula | C13H18FN3O4S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-(2-fluoro-6-nitrophenyl)sulfonyl-3,3-dimethylpiperidin-4-amine |
| SMILES | CC1(C)CN(S(=O)(=O)c2c(F)cccc2[N+](=O)[O-])CCC1N |
| InChI | InChI=1S/C13H18FN3O4S/c1-13(2)8-16(7-6-11(13)15)22(20,21)12-9(14)4-3-5-10(12)17(18)19/h3-5,11H,6-8,15H2,1-2H3 |
| InChIKey | ILWCOAXKGLATBE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|