C17H19ClN2O4S2 — CID 17257615
1-(2-chlorophenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)methanesulfonamide (PubChem CID 17257615) has the molecular formula C17H19ClN2O4S2 and a molecular weight of 414.94 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)methanesulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 17257615 |
| Molecular Formula | C17H19ClN2O4S2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1Cl)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H19ClN2O4S2/c18-17-6-2-1-5-14(17)13-25(21,22)19-15-7-9-16(10-8-15)26(23,24)20-11-3-4-12-20/h1-2,5-10,19H,3-4,11-13H2 |
| InChIKey | DFEWQUQJDANDIH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |