C19H23ClN2O4S2 — CID 17312255
1-(4-chlorophenyl)-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methanesulfonamide (PubChem CID 17312255) has the molecular formula C19H23ClN2O4S2 and a molecular weight of 442.99 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methanesulfonamide.
| Compound Name | 1-(4-chlorophenyl)-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 17312255 |
| Molecular Formula | C19H23ClN2O4S2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methanesulfonamide |
| SMILES | CC1CCCN(S(=O)(=O)c2ccc(NS(=O)(=O)Cc3ccc(Cl)cc3)cc2)C1 |
| InChI | InChI=1S/C19H23ClN2O4S2/c1-15-3-2-12-22(13-15)28(25,26)19-10-8-18(9-11-19)21-27(23,24)14-16-4-6-17(20)7-5-16/h4-11,15,21H,2-3,12-14H2,1H3 |
| InChIKey | GKFLQRFOTGMYEF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |