C14H12BrCl2NO3S2 — CID 97106617
(2S)-4-(5-bromothiophen-2-yl)sulfonyl-2-(3,5-dichlorophenyl)morpholine (PubChem CID 97106617) has the molecular formula C14H12BrCl2NO3S2 and a molecular weight of 457.20 g/mol. Its IUPAC name is (2S)-4-(5-bromothiophen-2-yl)sulfonyl-2-(3,5-dichlorophenyl)morpholine.
| Compound Name | (2S)-4-(5-bromothiophen-2-yl)sulfonyl-2-(3,5-dichlorophenyl)morpholine |
|---|---|
| PubChem CID | 97106617 |
| Molecular Formula | C14H12BrCl2NO3S2 |
| Molecular Weight | 457.20 g/mol |
| Exact Mass | 454.88 |
| IUPAC Name | (2S)-4-(5-bromothiophen-2-yl)sulfonyl-2-(3,5-dichlorophenyl)morpholine |
| SMILES | O=S(=O)(c1ccc(Br)s1)N1CCO[C@@H](c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C14H12BrCl2NO3S2/c15-13-1-2-14(22-13)23(19,20)18-3-4-21-12(8-18)9-5-10(16)7-11(17)6-9/h1-2,5-7,12H,3-4,8H2/t12-/m1/s1 |
| InChIKey | ZOCCWDQMCNMZGQ-GFCCVEGCSA-N |
| XLogP | 4.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.20 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |