C15H16ClNO3S2 — CID 110364559
4-(5-chlorothiophen-2-yl)sulfonyl-2-(2-methylphenyl)morpholine (PubChem CID 110364559) has the molecular formula C15H16ClNO3S2 and a molecular weight of 357.88 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)sulfonyl-2-(2-methylphenyl)morpholine.
| Compound Name | 4-(5-chlorothiophen-2-yl)sulfonyl-2-(2-methylphenyl)morpholine |
|---|---|
| PubChem CID | 110364559 |
| Molecular Formula | C15H16ClNO3S2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)sulfonyl-2-(2-methylphenyl)morpholine |
| SMILES | Cc1ccccc1C1CN(S(=O)(=O)c2ccc(Cl)s2)CCO1 |
| InChI | InChI=1S/C15H16ClNO3S2/c1-11-4-2-3-5-12(11)13-10-17(8-9-20-13)22(18,19)15-7-6-14(16)21-15/h2-7,13H,8-10H2,1H3 |
| InChIKey | ZJMIMHYTSAWTCX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |