C15H15Cl2NO3S2 — CID 110364335
2-(3,4-dichlorophenyl)-4-(5-methylthiophen-2-yl)sulfonylmorpholine (PubChem CID 110364335) has the molecular formula C15H15Cl2NO3S2 and a molecular weight of 392.33 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-4-(5-methylthiophen-2-yl)sulfonylmorpholine.
| Compound Name | 2-(3,4-dichlorophenyl)-4-(5-methylthiophen-2-yl)sulfonylmorpholine |
|---|---|
| PubChem CID | 110364335 |
| Molecular Formula | C15H15Cl2NO3S2 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-4-(5-methylthiophen-2-yl)sulfonylmorpholine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOC(c3ccc(Cl)c(Cl)c3)C2)s1 |
| InChI | InChI=1S/C15H15Cl2NO3S2/c1-10-2-5-15(22-10)23(19,20)18-6-7-21-14(9-18)11-3-4-12(16)13(17)8-11/h2-5,8,14H,6-7,9H2,1H3 |
| InChIKey | PMBTZQBCHZKKJS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |