C15H18ClN3O3S — CID 95167565
(2R)-2-(4-chlorophenyl)-4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholine (PubChem CID 95167565) has the molecular formula C15H18ClN3O3S and a molecular weight of 355.85 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)-4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholine.
| Compound Name | (2R)-2-(4-chlorophenyl)-4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholine |
|---|---|
| PubChem CID | 95167565 |
| Molecular Formula | C15H18ClN3O3S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)-4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholine |
| SMILES | Cc1nc(S(=O)(=O)N2CCO[C@H](c3ccc(Cl)cc3)C2)cn1C |
| InChI | InChI=1S/C15H18ClN3O3S/c1-11-17-15(10-18(11)2)23(20,21)19-7-8-22-14(9-19)12-3-5-13(16)6-4-12/h3-6,10,14H,7-9H2,1-2H3/t14-/m0/s1 |
| InChIKey | JSNCCWIQQYPUAB-AWEZNQCLSA-N |
| XLogP | 2.14 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |