C18H29N3O2 — CID 97435614
(6R)-1-benzyl-4-(2-morpholin-4-ylethyl)-1,4-diazepan-6-ol (PubChem CID 97435614) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is (6R)-1-benzyl-4-(2-morpholin-4-ylethyl)-1,4-diazepan-6-ol.
| Compound Name | (6R)-1-benzyl-4-(2-morpholin-4-ylethyl)-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 97435614 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (6R)-1-benzyl-4-(2-morpholin-4-ylethyl)-1,4-diazepan-6-ol |
| SMILES | O[C@H]1CN(CCN2CCOCC2)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H29N3O2/c22-18-15-20(7-6-19-10-12-23-13-11-19)8-9-21(16-18)14-17-4-2-1-3-5-17/h1-5,18,22H,6-16H2/t18-/m0/s1 |
| InChIKey | WUXUALHWKFMQCU-SFHVURJKSA-N |
| XLogP | 0.50 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |